Fluorinated greases comprising: (A) from 1% to 50% by weight of a thickener; (B) from 99% to 50% by weight of a mixture of: (B1) from 0, 1 to 100% by weight of a compound of structure: X1—O(CF2O)n(CF2CF2O)m(CF2CF2CF2O)p(CF2CF2CF2CF2O)q—X2  (I) wherein: X1, X2 have formula —(CF2)ZCF3 wherein z is an integer between 0 and 3; n is an integer between 1 and 200; m is an integer between 0 and 200; p, q are integers between 0 and 10; with the proviso that: the (p+q)/(p+q+m+n)≦0.05; m/n≦0.7; the number average molecular weight of (I) is between 1,000 and 10,000; the kinematic viscosity at 40° C. is lower than 20 cSt; and (B2) from 99.9% to 0% by weight of a perfluoropolyether oil having a kinematic viscosity at 40° C. higher than 15 cSt and comprising repeating units of the type (CFXO) wherein X is F or CF3; —CF2CF2O—, —C3F6O, —CF(CF3) CF2O, —CF2CF (CF3) O—, statistically distributed along the chain.